Jump to:
loading...| Preferred Name | vincamine | |
| Synonyms |
|
|
| Definitions |
An alkaloid ester that has formula C21H26N2O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9985 |
|
| alternative term |
C21H26N2O3 (+)-Vincamine Vincamine InChIKey=RXPRRQLKFXBCSJ-GIVPXCGWSA-N methyl 14beta-hydroxy-14,15-dihydro-3alpha,16alpha-eburnamenine-14alpha-carboxylate [H][C@]12N3CCC[C@@]1(CC)C[C@](O)(C(=O)OC)n1c2c(CC3)c2ccccc12 Vincamidol Methyl vincaminate InChI=1S/C21H26N2O3/c1-3-20-10-6-11-22-12-9-15-14-7-4-5-8-16(14)23(17(15)18(20)22)21(25,13-20)19(24)26-2/h4-5,7-8,18,25H,3,6,9-13H2,1-2H3/t18-,20+,21+/m1/s1 Pervincamine |
|
| definition |
An alkaloid ester that has formula C21H26N2O3. |
|
| has functional parent | ||
| has role | ||
| label |
vincamine |
|
| prefixIRI |
CHEBI:9985 |
|
| prefLabel |
vincamine |
|
| subClassOf |
Create mapping