Link to this page
BioModels Ontology
Last uploaded:
April 3, 2012
Jump to:
| Preferred Name | ursodeoxycholic acid | |
| Synonyms |
|
|
| Definitions |
A bile acid found in the bile of bears (Ursidae) as a conjugate with taurine. Used therapeutically, it prevents the synthesis and absorption of cholesterol and can lead to the dissolution of gallstones. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9907 |
|
| alternative term |
3alpha,7beta-dihydroxy-5beta-cholan-24-oic acid (3alpha,5beta,7beta)-3,7-dihydroxycholan-24-oic acid InChIKey=RUDATBOHQWOJDD-UZVSRGJWSA-N [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@]([H])(CC[C@@]3([H])[C@]1([H])[C@@H](O)C2)[C@H](C)CCC(O)=O Actigall C24H40O4 InChI=1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-/m1/s1 Ursodiol Ursodeoxycholic acid
|
|
| definition |
A bile acid found in the bile of bears (Ursidae) as a conjugate with taurine. Used therapeutically, it prevents the synthesis and absorption of cholesterol and can lead to the dissolution of gallstones.
|
|
| label |
ursodeoxycholic acid
|
|
| prefixIRI |
CHEBI:9907
|
|
| prefLabel |
ursodeoxycholic acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping