Jump to:
loading...| Preferred Name | taurodeoxycholic acid | |
| Synonyms |
|
|
| Definitions |
A bile acid taurine conjugate that has formula C26H45NO6S. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9410 |
|
| alternative term |
[H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCC(=O)NCCS(O)(=O)=O)[C@@]4(C)[C@@H](O)C[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 Taurodeoxycholate taurodeoxycholic acid 2-[(3alpha,12alpha-dihydroxy-24-oxo-5beta-cholan-24-yl)amino]ethanesulfonic acid C26H45NO6S InChI=1S/C26H45NO6S/c1-16(4-9-24(30)27-12-13-34(31,32)33)20-7-8-21-19-6-5-17-14-18(28)10-11-25(17,2)22(19)15-23(29)26(20,21)3/h16-23,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17-,18-,19+,20-,21+,22+,23+,25+,26-/m1/s1 InChIKey=AWDRATDZQPNJFN-VAYUFCLWSA-N |
|
| definition |
A bile acid taurine conjugate that has formula C26H45NO6S. |
|
| has functional parent | ||
| is conjugate acid of | ||
| label |
taurodeoxycholic acid |
|
| prefixIRI |
CHEBI:9410 |
|
| prefLabel |
taurodeoxycholic acid |
|
| subClassOf |
Create mapping