Jump to:
loading...| Preferred Name | promazine hydrochloride | |
| Synonyms |
|
|
| Definitions |
A hydrochloride that has formula C17H20N2S.HCl. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8460 |
|
| alternative term |
10-(gamma-Dimethylamino-n-propyl)phenothiazine hydrochloride N,N-dimethyl-3-(10H-phenothiazin-10-yl)propan-1-amine hydrochloride InChI=1S/C17H20N2S.ClH/c1-18(2)12-7-13-19-14-8-3-5-10-16(14)20-17-11-6-4-9-15(17)19;/h3-6,8-11H,7,12-13H2,1-2H3;1H 10H-Phenothiazine-10-propanamine, N,N-dimethyl-,monohydrochloride 10-(3-(Dimethylamino)propyl)phenothiazine monohydrochloride C17H21ClN2S Protactyl [H+].[Cl-].CN(C)CCCN1c2ccccc2Sc2ccccc12 C17H20N2S.HCl InChIKey=JIVSXRLRGOICGA-UHFFFAOYSA-N |
|
| definition |
A hydrochloride that has formula C17H20N2S.HCl. |
|
| has part | ||
| label |
promazine hydrochloride |
|
| prefixIRI |
CHEBI:8460 |
|
| prefLabel |
promazine hydrochloride |
|
| subClassOf |
Create mapping