Jump to:
loading...| Preferred Name |
procainamide hydrochloride |
|
| Synonyms |
|
|
| Definitions |
A hydrochloride which has procainamide as the amino component. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8429 |
|
| alternative term |
Procan C13H22ClN3O [H+].[Cl-].CCN(CC)CCNC(=O)c1ccc(N)cc1 Procanbid 4-amino-N-[2-(diethylamino)ethyl]benzamide hydrochloride C13H21N3O.HCl InChI=1S/C13H21N3O.ClH/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11;/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17);1H Procamide InChIKey=ABTXGJFUQRCPNH-UHFFFAOYSA-N Procapan PA Pronestyl |
|
| definition |
A hydrochloride which has procainamide as the amino component. |
|
| has part | ||
| has role | ||
| label |
procainamide hydrochloride |
|
| prefixIRI |
CHEBI:8429 |
|
| prefLabel |
procainamide hydrochloride |
|
| subClassOf |
Create mapping