Preferred Name |
procainamide |
|
Synonyms |
|
|
Definitions |
4-Aminobenzamide substituted on the amide N by a 2-(diethylamino)ethyl group. It is a pharmaceutical antiarrhythmic agent used for the medical treatment of cardiac arrhythmias. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8428 |
|
alternative term |
CCN(CC)CCNC(=O)c1ccc(N)cc1 Procainamide procainamide InChIKey=REQCZEXYDRLIBE-UHFFFAOYSA-N procainamidum 4-amino-N-[2-(diethylamino)ethyl]benzamide p-Amino-N-(2-diethylaminoethyl)benzamide p-Aminobenzoic diethylaminoethylamide procainamida Biocoryl C13H21N3O InChI=1S/C13H21N3O/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17) |
|
definition |
4-Aminobenzamide substituted on the amide N by a 2-(diethylamino)ethyl group. It is a pharmaceutical antiarrhythmic agent used for the medical treatment of cardiac arrhythmias. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_38070 |
|
label |
procainamide |
|
prefixIRI |
CHEBI:8428 |
|
prefLabel |
procainamide |
|
subClassOf |