Jump to:
loading...| Preferred Name |
phenyl acetate |
|
| Synonyms |
|
|
| Definitions |
An acetate ester that has formula C8H8O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8082 |
|
| alternative term |
InChI=1S/C8H8O2/c1-7(9)10-8-5-3-2-4-6-8/h2-6H,1H3 Acetylphenol InChIKey=IPBVNPXQWQGGJP-UHFFFAOYSA-N Phenyl acetate phenyl acetate C8H8O2 CC(=O)Oc1ccccc1 Phenol acetate Acetic acid,phenyl ester |
|
| definition |
An acetate ester that has formula C8H8O2. |
|
| has functional parent | ||
| label |
phenyl acetate |
|
| prefixIRI |
CHEBI:8082 |
|
| prefLabel |
phenyl acetate |
|
| subClassOf |
Create mapping