Jump to:
loading...| Preferred Name |
palmitate |
|
| Synonyms |
|
|
| Definitions |
The conjugate base of palmitic acid; major species at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7896 |
|
| alternative term |
CH3-[CH2]14-COO(-) InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1 n-hexadecoate CCCCCCCCCCCCCCCC([O-])=O n-hexadecanoate 1-pentadecanecarboxylate Hexadecanoic acid, ion(1-) palmitate C16H31O2 pentadecanecarboxylate hexadecanoate InChIKey=IPCSVZSSVZVIGE-UHFFFAOYSA-M |
|
| definition |
The conjugate base of palmitic acid; major species at pH 7.3. |
|
| is conjugate base of | ||
| label |
palmitate |
|
| prefixIRI |
CHEBI:7896 |
|
| prefLabel |
palmitate |
|
| subClassOf |
Create mapping