Preferred Name |
miconazole |
|
Synonyms |
|
|
Definitions |
An imidazole antifungal agent, commonly applied topically (to the skin) or mucus membranes to cure fungal infections. It inhibits the synthesis of ergosterol, a critical component of fungal cell membranes. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6923 |
|
alternative term |
1-[2-(2,4-dichlorobenzyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole Clc1ccc(COC(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1 Miconazole 1-(2,4-Dichloro-beta-((2,4-dichlorobenzyl)oxy)phenethyl)imidazole 1-[2-(2,4-Dichloro-benzyloxy)-2-(2,4-dichloro-phenyl)-ethyl]-1H-imidazole InChIKey=BYBLEWFAAKGYCD-UHFFFAOYSA-N Monistat IV (TN) InChI=1S/C18H14Cl4N2O/c19-13-2-1-12(16(21)7-13)10-25-18(9-24-6-5-23-11-24)15-4-3-14(20)8-17(15)22/h1-8,11,18H,9-10H2 Daktarin IV |
|
definition |
An imidazole antifungal agent, commonly applied topically (to the skin) or mucus membranes to cure fungal infections. It inhibits the synthesis of ergosterol, a critical component of fungal cell membranes. |
|
has role | ||
label |
miconazole |
|
prefixIRI |
CHEBI:6923 |
|
prefLabel |
miconazole |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24780 |