Preferred Name |
mexiletine |
|
Synonyms |
|
|
Definitions |
Mexiletine is an aromatic ether, being the 2,6-dimethylphenyl ether of 2-aminopropan-1-ol. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6916 |
|
alternative term |
1-methyl-2-(2,6-xylyloxy)ethanamine (2RS)-1-(2,6-dimethylphenoxy)-2-aminopropane CC(N)COc1c(C)cccc1C 1-(2,6-dimethylphenoxy)-2-propanamine InChIKey=VLPIATFUUWWMKC-UHFFFAOYSA-N 1-(2',6'-dimethylphenoxy)-2-aminopropane mexiletinum C11H17NO Mexiletine 1-(2,6-dimethylphenoxy)propan-2-amine InChI=1S/C11H17NO/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6,10H,7,12H2,1-3H3 mexiletina mexiletine (+-)-1-(2,6-dimethylphenoxy)propan-2-amine |
|
definition |
Mexiletine is an aromatic ether, being the 2,6-dimethylphenyl ether of 2-aminopropan-1-ol. |
|
has role | ||
label |
mexiletine |
|
prefixIRI |
CHEBI:6916 |
|
prefLabel |
mexiletine |
|
subClassOf |
Create mapping