loading...| Preferred Name | desoximetasone | |
| Synonyms |
|
|
| Definitions |
Dexamethasone in which the hydroxy group at the 17alpha position is substituted by hydrogen. A synthetic corticosteroid with glucocorticoid activity, it is used as an anti-inflammatory and anti-pruritic in the treatment of various skin disorders, including skin allergies and psoriasis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_691037 |
|
| alternative term |
desoximetasone 9alpha-fluoro-16alpha-methyl-Delta(1)-corticosterone C22H29FO4 (11beta,16alpha)-9-fluoro-11,21-dihydroxy-16-methylpregna-1,4-diene-3,20-dione desoximetasonum desoxymethasone InChI=1S/C22H29FO4/c1-12-8-16-15-5-4-13-9-14(25)6-7-21(13,3)22(15,23)18(27)10-20(16,2)19(12)17(26)11-24/h6-7,9,12,15-16,18-19,24,27H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,18+,19-,20+,21+,22+/m1/s1 desoximetasona InChIKey=VWVSBHGCDBMOOT-IIEHVVJPSA-N 9-fluoro-11beta,21-dihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione [H][C@@]12C[C@@H](C)[C@H](C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C |
|
| definition |
Dexamethasone in which the hydroxy group at the 17alpha position is substituted by hydrogen. A synthetic corticosteroid with glucocorticoid activity, it is used as an anti-inflammatory and anti-pruritic in the treatment of various skin disorders, including skin allergies and psoriasis. |
|
| has role | ||
| label |
desoximetasone |
|
| prefixIRI |
CHEBI:691037 |
|
| prefLabel |
desoximetasone |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_35344 |