loading...| Preferred Name | mepivacaine | |
| Synonyms |
|
|
| Definitions |
A piperidinecarboxamide-based local amide anaesthetic (amide caine) in which N-methylpipecolic acid and 2,6-dimethylaniline have combined to form the amide bond. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6759 |
|
| alternative term |
mepivacaine CN1CCCCC1C(=O)Nc1c(C)cccc1C N-(2,6-Dimethylphenyl)-1-methylpiperidine-2-carboxamide mepivacainum C15H22N2O N-(2,6-Dimethylphenyl)-1-methyl-2-piperidinecarboxamide mepivacaina 1-methyl-2',6'-pipecoloxylidide Carbocaine DL-Mepivacaine (+-)-1-Methyl-2',6'-pipecoloxylidide InChI=1S/C15H22N2O/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18) InChIKey=INWLQCZOYSRPNW-UHFFFAOYSA-N |
|
| definition |
A piperidinecarboxamide-based local amide anaesthetic (amide caine) in which N-methylpipecolic acid and 2,6-dimethylaniline have combined to form the amide bond. |
|
| has role | ||
| label |
mepivacaine |
|
| prefixIRI |
CHEBI:6759 |
|
| prefLabel |
mepivacaine |
|
| subClassOf |