loading...| Preferred Name |
lysergic acid diethylamide |
|
| Synonyms |
|
|
| Definitions |
An ergoline alkaloid arising from formal condensation of lysergic acid with diethylamine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6605 |
|
| alternative term |
LSD N,N-diethyllysergamide Lysergic acid diethylamide InChIKey=VAYOSLLFUXYJDT-RDTXWAMCSA-N [H][C@@]12Cc3c[nH]c4cccc(C1=C[C@H](CN2C)C(=O)N(CC)CC)c34 Lysergide Lysergsaeurediaethylamid LSD 25 (+)-LSD (8R)-9,10-didehydro-N,N-diethyl-6-methylergoline-8-carboxamide N,N-diethyl-D-lysergamide Lysergsaeurediethylamid C20H25N3O D-lysergic acid diethylamide N,N-diethyl-(+)-lysergamide InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3/t14-,18-/m1/s1 |
|
| definition |
An ergoline alkaloid arising from formal condensation of lysergic acid with diethylamine. |
|
| has functional parent | ||
| has role | ||
| label |
lysergic acid diethylamide |
|
| prefixIRI |
CHEBI:6605 |
|
| prefLabel |
lysergic acid diethylamide |
|
| subClassOf |