Jump to:
loading...| Preferred Name |
levacetylmethadol |
|
| Synonyms |
|
|
| Definitions |
A tertiary amino compound that has formula C23H31NO2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6441 |
|
| alternative term |
levacetilmetadol (-)-alpha-Acetylmethadol Levomethadyl acetate Levomethadyl levacetylmethadolum Orlaam CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1 InChIKey=XBMIVRRWGCYBTQ-AVRDEDQJSA-N InChI=1S/C23H31NO2/c1-6-22(26-19(3)25)23(17-18(2)24(4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,18,22H,6,17H2,1-5H3/t18-,22-/m0/s1 C23H31NO2 LAAM (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-2-yl acetate (1S,4S)-4-(dimethylamino)-1-ethyl-2,2-diphenylpentyl acetate 1-alpha-Acetylmethadol Levacetylmethadol levacetylmethadol |
|
| definition |
A tertiary amino compound that has formula C23H31NO2. |
|
| has role | ||
| label |
levacetylmethadol |
|
| prefixIRI |
CHEBI:6441 |
|
| prefLabel |
levacetylmethadol |
|
| subClassOf |
Create mapping