loading...| Preferred Name |
difenoxin hydrochloride |
|
| Synonyms |
|
|
| Definitions |
The hydrochloride salt of difenoxin. It has similar actions and uses to diphenoxylate hydrochloride, being administered for the symptomatic treatment of acute and chronic diarrhoea. In an attempt to discourage abuse (at high doses, difenoxin acts like morphine), preparations usually contain subclinical amounts of atropine sulfate. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59790 |
|
| alternative term |
InChIKey=VMIZTXDGZPTKIK-UHFFFAOYSA-N 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylic acid hydrochloride difenoxin HCl diphenoxylic acid hydrochloride [Cl-].OC(=O)C1(CC[NH+](CC1)CCC(C#N)(c1ccccc1)c1ccccc1)c1ccccc1 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid hydrochloride 4-carboxy-1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidinium chloride C28H29ClN2O2 InChI=1S/C28H28N2O2.ClH/c29-22-28(24-12-6-2-7-13-24,25-14-8-3-9-15-25)18-21-30-19-16-27(17-20-30,26(31)32)23-10-4-1-5-11-23;/h1-15H,16-21H2,(H,31,32);1H |
|
| definition |
The hydrochloride salt of difenoxin. It has similar actions and uses to diphenoxylate hydrochloride, being administered for the symptomatic treatment of acute and chronic diarrhoea. In an attempt to discourage abuse (at high doses, difenoxin acts like morphine), preparations usually contain subclinical amounts of atropine sulfate. |
|
| has part | ||
| has role | ||
| label |
difenoxin hydrochloride |
|
| prefixIRI |
CHEBI:59790 |
|
| prefLabel |
difenoxin hydrochloride |
|
| subClassOf |