loading...| Preferred Name |
cephapirin |
|
| Synonyms |
|
|
| Definitions |
A cephalosporin with acetoxymethyl and 2(pyridin-4-ylsulfanyl)acetamido substituents at positions 3 and 7, respectively, of the cephem skeleton. It is used (as its sodium salt) as an antibiotic, being effective against gram-negative and gram-positive organisms. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_554446 |
|
| alternative term |
CEPR InChIKey=UQLLWWBDSUHNEB-CZUORRHYSA-N cefapirina [H][C@]12SCC(COC(C)=O)=C(N1C(=O)[C@H]2NC(=O)CSc1ccncc1)C(O)=O Cephapirine (6R,7R)-3-acetoxymethyl-7-[(pyridin-4-ylsulfanyl)acetamido]-3,4-didehydrocepham-4-carboxylic acid (6R,7R)-3-(acetoxymethyl)-8-oxo-7-{[(pyridin-4-ylsulfanyl)acetyl]amino}-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid InChI=1S/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1 C17H17N3O6S2 cefapirine cefapirinum cefapirin Cefaprin |
|
| definition |
A cephalosporin with acetoxymethyl and 2(pyridin-4-ylsulfanyl)acetamido substituents at positions 3 and 7, respectively, of the cephem skeleton. It is used (as its sodium salt) as an antibiotic, being effective against gram-negative and gram-positive organisms. |
|
| has role | ||
| is conjugate acid of | ||
| label |
cephapirin |
|
| prefixIRI |
CHEBI:554446 |
|
| prefLabel |
cephapirin |
|
| subClassOf |