Preferred Name |
methyl cellulose |
|
Synonyms |
|
|
Definitions |
A (1->4)-beta-D-glucan compound formed by methylating cellulose through exposure to NaOH/CH3Cl. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_53448 |
|
alternative term |
cellulose methyl ether Methylcellulose InChI=1S/C29H54O16/c1-30-12-15-18(33-4)21(34-5)25(38-9)28(42-15)45-20-17(14-32-3)43-29(26(39-10)23(20)36-7)44-19-16(13-31-2)41-27(40-11)24(37-8)22(19)35-6/h15-29H,12-14H2,1-11H3/t15-,16-,17-,18-,19-,20-,21+,22+,23+,24-,25-,26-,27-,28+,29+/m1/s1 InChIKey=LNAZSHAWQACDHT-XIYTZBAFSA-N Cellulose methyl Cellulose methylate Methylcellulosum Metilcelulosa E461 (C9H16O5)n methylated cellulose methylcellulose |
|
definition |
A (1->4)-beta-D-glucan compound formed by methylating cellulose through exposure to NaOH/CH3Cl. |
|
has functional parent | ||
label |
methyl cellulose |
|
prefixIRI |
CHEBI:53448 |
|
prefLabel |
methyl cellulose |
|
subClassOf |
Create mapping