loading...| Preferred Name | lormetazepam | |
| Synonyms |
|
|
| Definitions |
A 1,4-benzodiazepinone compound having a methyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-chlorophenyl group at the 5-position and a chloro substituent at the 7-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_52993 |
|
| alternative term |
Loramet (TN) O-Chlorooxazepam 7-Chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one 7-Chloro-5-(o-chlorophenyl)-1,3-dihydro-3-hydroxy-1-methyl-2H-1,4-benzodiazepin-2-one Methyllorazepam (+-)-Lorazepam InChI=1S/C16H12Cl2N2O2/c1-20-13-7-6-9(17)8-11(13)14(19-15(21)16(20)22)10-4-2-3-5-12(10)18/h2-8,15,21H,1H3 lormetazepamum Lorazepam O-Chloroxazepam InChIKey=FJIKWRGCXUCUIG-UHFFFAOYSA-N C16H12Cl2N2O2 CN1C(=O)C(O)N=C(c2ccccc2Cl)c2cc(Cl)ccc12 Lormetazepam N-Methyllorazepam |
|
| definition |
A 1,4-benzodiazepinone compound having a methyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-chlorophenyl group at the 5-position and a chloro substituent at the 7-position. |
|
| has role | ||
| label |
lormetazepam |
|
| prefixIRI |
CHEBI:52993 |
|
| prefLabel |
lormetazepam |
|
| subClassOf |