loading...| Preferred Name |
alverine |
|
| Synonyms |
|
|
| Definitions |
A tertiary amine having one ethyl two 3-phenylprop-1-yl groups attached to the nitrogen. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_518413 |
|
| alternative term |
CCN(CCCc1ccccc1)CCCc1ccccc1 alverine InChI=1S/C20H27N/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20/h3-8,11-14H,2,9-10,15-18H2,1H3 Di(phenylpropyl)ethylamine alverinum N-Ethyl-N-(3-phenylpropyl)benzenepropanamine InChIKey=ZPFXAOWNKLFJDN-UHFFFAOYSA-N C20H27N Bis(gamma-phenylpropyl)ethylamine N-Ethyl-3,3'-diphenyldipropylamine N-Ethyl-3-phenyl-N-(3-phenylpropyl)-1-propanamine N,N-Bis(3-phenylpropyl)ethylamine alverina N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine Phenopropamine Phenpropamine |
|
| definition |
A tertiary amine having one ethyl two 3-phenylprop-1-yl groups attached to the nitrogen. |
|
| has role | ||
| label |
alverine |
|
| prefixIRI |
CHEBI:518413 |
|
| prefLabel |
alverine |
|
| subClassOf |