Jump to:
loading...| Preferred Name | amoxicillin sodium | |
| Synonyms |
|
|
| Definitions |
An organic sodium salt that has formula C16H18N3NaO5S. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_51255 |
|
| alternative term |
InChI=1S/C16H19N3O5S.Na/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);/q;+1/p-1/t9-,10-,11+,14-;/m1./s1 [Na+].[H][C@]12SC(C)(C)[C@@H](N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccc(O)cc1)C([O-])=O amoxicillin natrium Ibiamox C16H18N3NaO5S InChIKey=BYHDFCISJXIVBV-YWUHCJSESA-M sodium 6beta-[(2R)-2-amino-2-(4-hydroxyphenyl)acetamido]-2,2-dimethylpenam-3alpha-carboxylate |
|
| definition |
An organic sodium salt that has formula C16H18N3NaO5S. |
|
| has part | ||
| label |
amoxicillin sodium |
|
| prefixIRI |
CHEBI:51255 |
|
| prefLabel |
amoxicillin sodium |
|
| subClassOf |
Create mapping