Preferred Name | mercaptopurine | |
Synonyms |
|
|
Definitions |
A purine that has formula C5H4N4S. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_50667 |
|
alternative term |
InChIKey=GLVAUDGFNGKCSF-UHFFFAOYSA-N 1,7-dihydro-6H-purine-6-thione 6 MP mercaptopurinum Puri-Nethol 6-Mercaptopurine C5H4N4S 6-Thiohypoxanthine 6-Thioxopurine S=c1[nH]cnc2nc[nH]c12 mercaptopurine 6-MP Mercaptopurina Mercapurin Purinethol InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
|
definition |
A purine that has formula C5H4N4S. |
|
has role | ||
is tautomer of | ||
label |
mercaptopurine |
|
prefixIRI |
CHEBI:50667 |
|
prefLabel |
mercaptopurine |
|
subClassOf |
Create mapping