Jump to:
loading...| Preferred Name |
isobutyl acetate |
|
| Synonyms |
|
|
| Definitions |
An acetate ester that has formula C6H12O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_50569 |
|
| alternative term |
i-butyl acetate C6H12O2 Isobutylacetat 2-methylpropyl ethanoate isobutyl acetate acetic acid, 2-methylpropyl ester acetic acid, isobutyl ester InChIKey=GJRQTCIYDGXPES-UHFFFAOYSA-N acetate d'isobutyle CC(C)COC(C)=O isobutyl ethanoate 2-methyl-1-propyl acetate InChI=1S/C6H12O2/c1-5(2)4-8-6(3)7/h5H,4H2,1-3H3 Essigsaeureisobutylester 2-methylpropyl acetate Isobutylazetat beta-methylpropyl ethanoate |
|
| definition |
An acetate ester that has formula C6H12O2. |
|
| has functional parent | ||
| label |
isobutyl acetate |
|
| prefixIRI |
CHEBI:50569 |
|
| prefLabel |
isobutyl acetate |
|
| subClassOf |
Create mapping