Preferred Name |
etidocaine |
|
Synonyms |
|
|
Definitions |
An amide-based local anaesthetic (amide caine) in which 2-[ethyl(propyl)amino]butanoic acid and 2,6-dimethylaniline have combined to form the amide bond. It has rapid onset and long action properties, similar to bupivacaine, and is given by injection during surgical procedures; and labor and delivery. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4904 |
|
alternative term |
etidocaine etidocainum C17H28N2O N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide InChIKey=VTUSIVBDOCDNHS-UHFFFAOYSA-N (+-)-N-(2,6-Dimethylphenyl)-2-(ethylpropylamino)butanamide CCCN(CC)C(CC)C(=O)Nc1c(C)cccc1C (+-)-2-(Ethylpropylamino)-2',6'-butyroxylidide etidocaina InChI=1S/C17H28N2O/c1-6-12-19(8-3)15(7-2)17(20)18-16-13(4)10-9-11-14(16)5/h9-11,15H,6-8,12H2,1-5H3,(H,18,20) |
|
definition |
An amide-based local anaesthetic (amide caine) in which 2-[ethyl(propyl)amino]butanoic acid and 2,6-dimethylaniline have combined to form the amide bond. It has rapid onset and long action properties, similar to bupivacaine, and is given by injection during surgical procedures; and labor and delivery. |
|
has role | ||
label |
etidocaine |
|
prefixIRI |
CHEBI:4904 |
|
prefLabel |
etidocaine |
|
subClassOf |