loading...| Preferred Name |
thioridazine hydrochloride |
|
| Synonyms |
|
|
| Definitions |
A hydrochloride that has formula C21H26N2S2.HCl. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_48566 |
|
| alternative term |
Ridazin Mellaril Hydrochloride Thioridazine Hcl Mellerette [H+].[Cl-].CSc1ccc2Sc3ccccc3N(CCC3CCCCN3C)c2c1 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfanyl)-10H-phenothiazine hydrochloride C21H27ClN2S2 Thioridazine chloride Mellaril InChI=1S/C21H26N2S2.ClH/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23;/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3;1H 2-Methylmercapto-10-(2-(N-methyl-2-piperidyl)ethyl)phenothiazine hydrochloride Ridazine Melleril Mallorol Aldazine InChIKey=NZFNXWQNBYZDAQ-UHFFFAOYSA-N C21H26N2S2.HCl Meleril Orsanil Melleretten Sonapax Hydrochloride |
|
| definition |
A hydrochloride that has formula C21H26N2S2.HCl. |
|
| has part | ||
| has role | ||
| label |
thioridazine hydrochloride |
|
| prefixIRI |
CHEBI:48566 |
|
| prefLabel |
thioridazine hydrochloride |
|
| subClassOf |