loading...| Preferred Name |
dyclonine |
|
| Synonyms |
|
|
| Definitions |
N-Ethylpiperidine in which one of the hydrogens attached to the methyl group is substituted by a 4-butoxybenzoyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4724 |
|
| alternative term |
CCCCOc1ccc(cc1)C(=O)CCN1CCCCC1 4-n-butoxy-beta-(1-piperidyl)propiophenone dyclonine 1-(4-butoxyphenyl)-3-(1-piperidinyl)-1-propanone 2-(1-piperidyl)ethyl p-butoxyphenyl ketone 1-(4-butoxyphenyl)-3-(piperidin-1-yl)propan-1-one InChI=1S/C18H27NO2/c1-2-3-15-21-17-9-7-16(8-10-17)18(20)11-14-19-12-5-4-6-13-19/h7-10H,2-6,11-15H2,1H3 InChIKey=BZEWSEKUUPWQDQ-UHFFFAOYSA-N 4-butoxy-beta-piperidinopropiophenone diclonina dycloninum C18H27NO2 3-piperidino-4'-butoxypropiophenone 4'-butoxy-3-piperidinopropiophenone |
|
| definition |
N-Ethylpiperidine in which one of the hydrogens attached to the methyl group is substituted by a 4-butoxybenzoyl group. |
|
| has role | ||
| label |
dyclonine |
|
| prefixIRI |
CHEBI:4724 |
|
| prefLabel |
dyclonine |
|
| subClassOf |