Preferred Name | donepezil hydrochloride | |
Synonyms |
|
|
Definitions |
Donepezil hydrochloride is a centrally acting reversible acetyl cholinesterase inhibitor. Its main therapeutic use is in the treatment of Alzheimer's disease where it is used to increase cortical acetylcholine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4696 |
|
alternative term |
InChIKey=XWAIAVWHZJNZQQ-UHFFFAOYSA-N Donepezil HCl C24H29NO3.HCl C24H30ClNO3 1-benzyl-4-[(5,6-dimethoxy-1-oxo-2,3-dihydro-1H-inden-2-yl)methyl]piperidinium chloride [H+].[Cl-].COc1cc2CC(CC3CCN(CC3)Cc3ccccc3)C(=O)c2cc1OC (+-)-2-((1-Benzyl-4-piperidyl)methyl)-5,6-dimethoxy-1-indanone hydrochloride InChI=1S/C24H29NO3.ClH/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18;/h3-7,14-15,17,20H,8-13,16H2,1-2H3;1H Donepezil hydrochloride 1-Benzyl-4-((5,6-dimethoxy-1-indanon)-2-yl)methylpiperidine hcl |
|
definition |
Donepezil hydrochloride is a centrally acting reversible acetyl cholinesterase inhibitor. Its main therapeutic use is in the treatment of Alzheimer's disease where it is used to increase cortical acetylcholine. |
|
has parent hydride | ||
has part | ||
has role | ||
label |
donepezil hydrochloride |
|
prefixIRI |
CHEBI:4696 |
|
prefLabel |
donepezil hydrochloride |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36807 |