Preferred Name |
zoledronic acid |
|
Synonyms |
|
|
Definitions |
An imidazole compound having a 2,2-bis(phosphono)-2-hydroxyethane-1-yl substituent at the 1-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_46557 |
|
alternative term |
ZOLEDRONIC ACID (1-hydroxy-2-imidazol-1-ylethylidene)diphosphonic acid Reclast C5H10N2O7P2 zoledronic acid OC(Cn1ccnc1)(P(O)(O)=O)P(O)(O)=O ZOL InChIKey=XRASPMIURGNCCH-UHFFFAOYSA-N InChI=1S/C5H10N2O7P2/c8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7/h1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14) [1-hydroxy-2-(1H-imidazol-1-yl)ethane-1,1-diyl]bis(phosphonic acid) (1-hydroxy-2-(1H-imidazol-1-yl)ethylidene)bisphosphonic acid |
|
definition |
An imidazole compound having a 2,2-bis(phosphono)-2-hydroxyethane-1-yl substituent at the 1-position. |
|
has role | ||
label |
zoledronic acid |
|
prefixIRI |
CHEBI:46557 |
|
prefLabel |
zoledronic acid |
|
subClassOf |
Create mapping