loading...| Preferred Name | dipivefrin hydrochloride | |
| Synonyms |
|
|
| Definitions |
The hydrochloride salt of dipivefrin. It is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4647 |
|
| alternative term |
C19H30ClNO5 dipivefrine hydrochloride [Cl-].C[NH2+]CC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 InChI=1S/C19H29NO5.ClH/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6;/h8-10,13,20-21H,11H2,1-7H3;1H InChIKey=VKFAUCPBMAGVRG-UHFFFAOYSA-N 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol hydrochloride 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) hydrochloride dipivefrin HCl dipivefrine HCl 2-{3,4-bis[(2,2-dimethylpropanoyl)oxy]phenyl}-2-hydroxy-N-methylethanaminium chloride |
|
| definition |
The hydrochloride salt of dipivefrin. It is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_39456 http://purl.obolibrary.org/obo/CHEBI_35524 |
|
| label |
dipivefrin hydrochloride |
|
| prefixIRI |
CHEBI:4647 |
|
| prefLabel |
dipivefrin hydrochloride |
|
| subClassOf |