loading...| Preferred Name |
difenoxin |
|
| Synonyms |
|
|
| Definitions |
4-Phenylpiperidine-4-carboxylic acid in which the hydrogen attached to the nitrogen atom is substituted by a 3-cyano-3,3-diphenylpropyl group. The principal active metabolite of diphenoxylate, it has similar actions and uses, being administered as the hydrochloride for the symptomatic treatment of acute and chronic diarrhoea. In an attempt to discourage abuse (at high doses, difenoxin acts like morphine), preparations usually contain subclinical amounts of atropine sulfate. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4534 |
|
| alternative term |
difenoxina 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylic acid difenoxinum diphenoxylic acid OC(=O)C1(CCN(CC1)CCC(C#N)(c1ccccc1)c1ccccc1)c1ccccc1 InChI=1S/C28H28N2O2/c29-22-28(24-12-6-2-7-13-24,25-14-8-3-9-15-25)18-21-30-19-16-27(17-20-30,26(31)32)23-10-4-1-5-11-23/h1-15H,16-21H2,(H,31,32) InChIKey=UFIVBRCCIRTJTN-UHFFFAOYSA-N C28H28N2O2 diphenoxilic acid Difenoxin 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid difenoxin |
|
| definition |
4-Phenylpiperidine-4-carboxylic acid in which the hydrogen attached to the nitrogen atom is substituted by a 3-cyano-3,3-diphenylpropyl group. The principal active metabolite of diphenoxylate, it has similar actions and uses, being administered as the hydrochloride for the symptomatic treatment of acute and chronic diarrhoea. In an attempt to discourage abuse (at high doses, difenoxin acts like morphine), preparations usually contain subclinical amounts of atropine sulfate. |
|
| has role | ||
| label |
difenoxin |
|
| prefixIRI |
CHEBI:4534 |
|
| prefLabel |
difenoxin |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_32876 |