loading...| Preferred Name | dicyclomine | |
| Synonyms |
|
|
| Definitions |
The ester resulting from the formal condensation of 1-cyclohexylcyclohexanecarboxylic acid with 2-(diethylamino)ethanol. An anticholinergic, it is used as the hydrochloride to treat or prevent spasm in the muscles of the gastrointestinal tract, particularly that associated with irritable bowel syndrome. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4514 |
|
| alternative term |
InChI=1S/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3 dicycloverine 2-(diethylamino)ethyl 1-cyclohexylcyclohexanecarboxylate dicicloverina 2-(diethylamino)ethyl 1,1'-bi(cyclohexyl)-1-carboxylate CCN(CC)CCOC(=O)C1(CCCCC1)C1CCCCC1 C19H35NO2 Bicyclohexyl-1-carboxylic acid 2-diethylamino-ethyl ester dicycloverinum DICYCLOMINE Dicyclomine InChIKey=CURUTKGFNZGFSE-UHFFFAOYSA-N |
|
| definition |
The ester resulting from the formal condensation of 1-cyclohexylcyclohexanecarboxylic acid with 2-(diethylamino)ethanol. An anticholinergic, it is used as the hydrochloride to treat or prevent spasm in the muscles of the gastrointestinal tract, particularly that associated with irritable bowel syndrome. |
|
| has functional parent | ||
| has role | ||
| label |
dicyclomine |
|
| prefixIRI |
CHEBI:4514 |
|
| prefLabel |
dicyclomine |
|
| subClassOf |