loading...| Preferred Name |
carvone |
|
| Synonyms |
|
|
| Definitions |
The parent compound of the group of carvones, comprising cyclohex-2-enone having methyl and isopropenyl substituents at positions 2 and 5, respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38265 |
|
| alternative term |
Carvon 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one CC(=C)C1CC=C(C)C(=O)C1 carvol 2-methyl-5-(1-methyl-1-ethenyl)-2-cyclohexen-1-one 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-enone 2-methyl-5-isopropenyl-2-cyclohexenone InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3 2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one Karvon carvone C10H14O p-mentha-6,8-dien-2-one InChIKey=ULDHMXUKGWMISQ-UHFFFAOYSA-N p-mentha-1(6),8-dien-2-one 1-carvone 5-isopropenyl-2-methylcyclohex-2-en-1-one |
|
| definition |
The parent compound of the group of carvones, comprising cyclohex-2-enone having methyl and isopropenyl substituents at positions 2 and 5, respectively. |
|
| label |
carvone |
|
| prefixIRI |
CHEBI:38265 |
|
| prefLabel |
carvone |
|
| subClassOf |