Jump to:
loading...| Preferred Name |
clomiphene |
|
| Synonyms |
|
|
| Definitions |
A tertiary amine that has formula C26H28ClNO. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3752 |
|
| alternative term |
2-(p-(beta-chloro-alpha-phenylstyryl)phenoxy)triethylamine Clomifene clomifenum InChI=1S/C26H28ClNO/c1-3-28(4-2)19-20-29-24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23/h5-18H,3-4,19-20H2,1-2H3 C26H28ClNO 2-(p-(2-chloro-1,2-diphenylvinyl)phenoxy)triethylamine CCN(CC)CCOc1ccc(cc1)C(c1ccccc1)=C(Cl)c1ccccc1 2-(4-(2-chloro-1,2-diphenylethenyl)phenoxy)-N,N-diethylethanamine InChIKey=GKIRPKYJQBWNGO-UHFFFAOYSA-N Clomiphene clomifene clomifeno 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethylethanamine |
|
| definition |
A tertiary amine that has formula C26H28ClNO. |
|
| has parent hydride | ||
| has role | ||
| label |
clomiphene |
|
| prefixIRI |
CHEBI:3752 |
|
| prefLabel |
clomiphene |
|
| subClassOf |
Create mapping