loading...| Preferred Name | chlorzoxazone | |
| Synonyms |
|
|
| Definitions |
3H-1,3-Benzoxazol-2-one in which the hydrogen atom at position 5 is substituted by chlorine. A centrally acting muscle relaxant with sedative properties, it is used for the symptomatic treatment of painful muscle spasm. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3655 |
|
| alternative term |
chlorzoxazonum 5-chloro-2-benzoxazolinone 5-chloro-2-benzoxazolone 5-chlorobenzoxazolin-2-one InChIKey=TZFWDZFKRBELIQ-UHFFFAOYSA-N chlorzoxazone InChI=1S/C7H4ClNO2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) 2-hydroxy-5-chlorobenzoxazole chlorzoxane 5-chloro-2-hydroxybenzoxazole Chlorzoxazone CHLORZOXAZONE 5-chlorobenzoxazolidone Oc1nc2cc(Cl)ccc2o1 5-chloro-1,3-benzoxazol-2-ol C7H4ClNO2 5-chloro-2-benzoxazolol 5-chloro-1,3-benzoxazol-2(3H)-one 5-chloro-2(3H)-benzoxazolone chlorzoxazona |
|
| definition |
3H-1,3-Benzoxazol-2-one in which the hydrogen atom at position 5 is substituted by chlorine. A centrally acting muscle relaxant with sedative properties, it is used for the symptomatic treatment of painful muscle spasm. |
|
| has role | ||
| label |
chlorzoxazone |
|
| prefixIRI |
CHEBI:3655 |
|
| prefLabel |
chlorzoxazone |
|
| subClassOf |