Jump to:
loading...| Preferred Name |
protirelin |
|
| Synonyms |
|
|
| Definitions |
A peptide hormone that has formula C16H22N6O4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35940 |
|
| alternative term |
Thyrotropin-releasing factor L-Pyroglutamyl-L-histidyl-L-prolineamide C16H22N6O4 NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CCC(=O)N1 Thyrotropic releasing hormone Thyrotropin releasing hormone InChI=1S/C16H22N6O4/c17-14(24)12-2-1-5-22(12)16(26)11(6-9-7-18-8-19-9)21-15(25)10-3-4-13(23)20-10/h7-8,10-12H,1-6H2,(H2,17,24)(H,18,19)(H,20,23)(H,21,25)/t10-,11-,12-/m0/s1 Thyrotropic-releasing factor Protirelin TRH 5-oxo-L-prolyl-L-histidyl-L-prolinamide InChIKey=XNSAINXGIQZQOO-SRVKXCTJSA-N |
|
| definition |
A peptide hormone that has formula C16H22N6O4. |
|
| label |
protirelin |
|
| prefixIRI |
CHEBI:35940 |
|
| prefLabel |
protirelin |
|
| subClassOf |
Create mapping