loading...| Preferred Name | cephalexin | |
| Synonyms |
|
|
| Definitions |
A semisynthetic first-generation cephalosporin antibiotic having methyl and beta-(2R)-2-amino-2-phenylacetamido groups at the 3- and 7- of the cephem skeleton, respectively. It is effective against both Gram-negative and Gram-positive organisms, and is used for treatment of infections of the skin, respiratory tract and urinary tract. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3534 |
|
| alternative term |
7-(D-alpha-Aminophenylacetamido)desacetoxycephalosporanic acid InChI=1S/C16H17N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-6,10-11,15H,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 cefalexine C16H17N3O4S Ceporexin 7-beta-(D-alpha-Amino-alpha-phenylacetylamino)-3-methyl-3-cephem-4-carboxylic acid InChIKey=ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cefalexinum Cepexin Cepastar 7beta-[(2R)-2-amino-2-phenylacetamido]-3-methyl-3,4-didehydrocepham-4-carboxylic acid [H][C@]12SCC(C)=C(N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1)C(O)=O (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Cefalexin cefalexina Celexin CEX Cephacillin |
|
| definition |
A semisynthetic first-generation cephalosporin antibiotic having methyl and beta-(2R)-2-amino-2-phenylacetamido groups at the 3- and 7- of the cephem skeleton, respectively. It is effective against both Gram-negative and Gram-positive organisms, and is used for treatment of infections of the skin, respiratory tract and urinary tract. |
|
| has role | ||
| is conjugate acid of | ||
| label |
cephalexin |
|
| prefixIRI |
CHEBI:3534 |
|
| prefLabel |
cephalexin |
|
| subClassOf |