Jump to:
loading...| Preferred Name |
thiouracil |
|
| Synonyms |
|
|
| Definitions |
Uracil in which the oxo group at C-2 is replaced by a thioxo group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_348530 |
|
| alternative term |
InChIKey=ZEMGGZBWXRYJHK-UHFFFAOYSA-N C4H4N2OS 2-Thio-2,4-(1H,3H)-pyrimidinedione 2-Thioxo-2,3-dihydro-1H-pyrimidin-4-one O=c1cc[nH]c(=S)[nH]1 2-Mercapto-pyrimidin-4-ol InChI=1S/C4H4N2OS/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) 2-thioxo-2,3-dihydropyrimidin-4(1H)-one 2-Thiouracil |
|
| definition |
Uracil in which the oxo group at C-2 is replaced by a thioxo group. |
|
| has functional parent | ||
| label |
thiouracil |
|
| prefixIRI |
CHEBI:348530 |
|
| prefLabel |
thiouracil |
|
| subClassOf |
Create mapping