loading...| Preferred Name |
dibutyl phthalate |
|
| Synonyms |
|
|
| Definitions |
The dibutyl ester of benzene-1,2-dicarboxylic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34687 |
|
| alternative term |
Dibutyl 1,2-benzenedicarboxylate Dibutyl-o-phthalate Di-n-butyl phthalate C16H22O4 InChIKey=DOIRQSBPFJWKBE-UHFFFAOYSA-N InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 CCCCOC(=O)c1ccccc1C(=O)OCCCC n-Butyl phthalate Dibutyl o-phthalate Benzenedicarboxylic acid dibutyl ester dibutyl benzene-1,2-dicarboxylate 1,2-Benzenedicarboxylic acid dibutyl ester o-Benzenedicarboxylic acid dibutyl ester Benzene-o-dicarboxylic acid di-n-butyl ester Dibutyl phthalate DBP Phthalic acid di-n-butyl ester Phthalic acid dibutyl ester Butyl phthalate |
|
| definition |
The dibutyl ester of benzene-1,2-dicarboxylic acid. |
|
| label |
dibutyl phthalate |
|
| prefixIRI |
CHEBI:34687 |
|
| prefLabel |
dibutyl phthalate |
|
| subClassOf |