loading...| Preferred Name |
clofibric acid |
|
| Synonyms |
|
|
| Definitions |
A carboxylic acid that has formula C10H11ClO3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34648 |
|
| alternative term |
acido clofibrico PCPIB Chlorfibrinic acid Chlorofibrinic acid clofibric acid alpha-(4-chlorophenoxy)-alpha-methylpropionic acid PCIB Acide (p-chlorophenoxy)-2 methyl-2 propionique C10H11ClO3 acide clofibrique Clofibrate free acid alpha-(p-chlorophenoxy)isobutyric acid acidum clofibricum InChIKey=TXCGAZHTZHNUAI-UHFFFAOYSA-N Clofibric acid 4-CPIB CPIB CC(C)(Oc1ccc(Cl)cc1)C(O)=O 2-(p-Chlorophenoxy)-2-methylpropionic acid Clofibrinsaeure Chlorophibrinic acid 2-(4-Chlorophenoxy)-2-methylpropionic acid InChI=1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13) 2-(4-chlorophenoxy)-2-methylpropanoic acid 2-(p-Chlorophenoxy)isobutyric acid |
|
| definition |
A carboxylic acid that has formula C10H11ClO3. |
|
| has functional parent | ||
| has role | ||
| label |
clofibric acid |
|
| prefixIRI |
CHEBI:34648 |
|
| prefLabel |
clofibric acid |
|
| subClassOf |