Jump to:
loading...| Preferred Name |
2-hydroxyethyl methacrylate |
|
| Synonyms |
|
|
| Definitions |
The monomethacryloyl derivative of ethylene glycol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34288 |
|
| alternative term |
Glycol monomethacrylate 1,2-Ethanediol mono(2-methyl)-2-propenoate C6H10O3 2-(Methacryloyloxy)ethanol Hydroxyethyl methacrylate InChIKey=WOBHKFSMXKNTIM-UHFFFAOYSA-N Ethylene glycol monomethacrylate Glycol methacrylate 2-Hydroxyethylmethacrylate 2-Hydroxyethyl methacrylate CC(=C)C(=O)OCCO 2-hydroxyethyl methacrylate Ethylene glycol methacrylate 2-Hydroxyethyl 2-methylacrylate beta-Hydroxyethyl methacrylate InChI=1S/C6H10O3/c1-5(2)6(8)9-4-3-7/h7H,1,3-4H2,2H3 HEMA |
|
| definition |
The monomethacryloyl derivative of ethylene glycol. |
|
| has functional parent | ||
| label |
2-hydroxyethyl methacrylate |
|
| prefixIRI |
CHEBI:34288 |
|
| prefLabel |
2-hydroxyethyl methacrylate |
|
| subClassOf |
Create mapping