Link to this page
BioModels Ontology
Last uploaded:
April 3, 2012
Jump to:
| Preferred Name | D-gluconic acid | |
| Synonyms |
|
|
| Definitions |
A gluconic acid that has formula C6H12O7. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_33198 |
|
| alternative term |
D-gluconic acid D-Glukonsaeure OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O D-Gluconsaeure InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1 C6H12O7 GLUCONIC ACID InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluco-Hexonic acid Dextronic acid Gluconic acid D-Gluconic acid
|
|
| definition |
A gluconic acid that has formula C6H12O7.
|
|
| is conjugate acid of | ||
| label |
D-gluconic acid
|
|
| prefixIRI |
CHEBI:33198
|
|
| prefLabel |
D-gluconic acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping