Jump to:
loading...| Preferred Name | dexmedetomidine hydrochloride | |
| Synonyms |
|
|
| Definitions |
A medetomidine hydrochloride that has formula C13H16N2.HCl. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31472 |
|
| alternative term |
InChIKey=VPNGEIHDPSLNMU-MERQFXBCSA-N 4-((S)-alpha,2,3-trimethylbenzyl)imidazole monohydrochloride C13H16N2.HCl 4-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole hydrochloride C13H17ClN2 Precedex Cl.C[C@H](c1c[nH]cn1)c1cccc(C)c1C InChI=1S/C13H16N2.ClH/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13;/h4-8,11H,1-3H3,(H,14,15);1H/t11-;/m0./s1 |
|
| definition |
A medetomidine hydrochloride that has formula C13H16N2.HCl. |
|
| has part | ||
| has role | ||
| is enantiomer of | ||
| label |
dexmedetomidine hydrochloride |
|
| prefixIRI |
CHEBI:31472 |
|
| prefLabel |
dexmedetomidine hydrochloride |
|
| subClassOf |
Create mapping