Jump to:
loading...| Preferred Name |
butyl acetate |
|
| Synonyms |
|
|
| Definitions |
An acetate ester that has formula C6H12O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31328 |
|
| alternative term |
n-butyl ethanoate butyl ester of acetic acid butyl acetate C6H12O2 acetic acid, butyl ester Butyl acetate CCCCOC(C)=O Butylazetat Essigsaeurebutylester 1-butyl acetate n-butyl acetate acetic acid n-butyl ester Essigsaeure-n-butylester CH3COO(CH2)3CH3 1-acetoxybutane InChIKey=DKPFZGUDAPQIHT-UHFFFAOYSA-N acetate de butyle Butylacetat butyl ethanoate InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3 |
|
| definition |
An acetate ester that has formula C6H12O2. |
|
| label |
butyl acetate |
|
| prefixIRI |
CHEBI:31328 |
|
| prefLabel |
butyl acetate |
|
| subClassOf |
Create mapping