Jump to:
loading...| Preferred Name | isocitric acid | |
| Synonyms |
|
|
| Definitions |
A tricarboxylic acid that has formula C6H8O7. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30887 |
|
| alternative term |
InChIKey=ODBLHEXUDAPZAU-UHFFFAOYSA-N InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13) C6H8O7 Isocitric acid Isocitrate 1-Hydroxypropane-1,2,3-tricarboxylic acid 1-Hydroxytricarballylic acid OC(C(CC(O)=O)C(O)=O)C(O)=O 1-hydroxypropane-1,2,3-tricarboxylic acid |
|
| definition |
A tricarboxylic acid that has formula C6H8O7. |
|
| is conjugate acid of | ||
| label |
isocitric acid |
|
| prefixIRI |
CHEBI:30887 |
|
| prefLabel |
isocitric acid |
|
| subClassOf |
Create mapping