Jump to:
loading...| Preferred Name | 4-aminobenzoic acid | |
| Synonyms |
|
|
| Definitions |
An aminobenzoic acid that has formula C7H7NO2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30753 |
|
| alternative term |
4-Aminobenzoic acid InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-N C7H7NO2 p-aminobenzoic acid 4-aminobenzoic acid 4-AMINOBENZOIC ACID ABEE InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10) para-aminobenzoic acid p-Aminobenzoesaeure 4-Amino-benzoic acid Nc1ccc(cc1)C(O)=O PABA 4-Aminobenzoesaeure |
|
| definition |
An aminobenzoic acid that has formula C7H7NO2. |
|
| has functional parent | ||
| is conjugate acid of | ||
| label |
4-aminobenzoic acid |
|
| prefixIRI |
CHEBI:30753 |
|
| prefLabel |
4-aminobenzoic acid |
|
| subClassOf |
Create mapping