Jump to:
loading...| Preferred Name | glycocholate | |
| Synonyms |
|
|
| Definitions |
A steroid acid anion that is the conjugate base of glycocholic acid; major species at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29746 |
|
| alternative term |
InChI=1S/C26H43NO6/c1-14(4-7-22(31)27-13-23(32)33)17-5-6-18-24-19(12-21(30)26(17,18)3)25(2)9-8-16(28)10-15(25)11-20(24)29/h14-21,24,28-30H,4-13H2,1-3H3,(H,27,31)(H,32,33)/p-1/t14-,15+,16-,17-,18+,19+,20-,21+,24+,25+,26-/m1/s1 C26H42NO6 glycocholate [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@]3(C)[C@]([H])(CC[C@@]3([H])[C@]1([H])[C@H](O)C2)[C@H](C)CCC(=O)NCC([O-])=O N-(3alpha,7alpha,12alpha-trihydroxy-5beta-cholan-24-oyl)glycinate InChIKey=RFDAIACWWDREDC-FRVQLJSFSA-M |
|
| definition |
A steroid acid anion that is the conjugate base of glycocholic acid; major species at pH 7.3. |
|
| is conjugate base of | ||
| label |
glycocholate |
|
| prefixIRI |
CHEBI:29746 |
|
| prefLabel |
glycocholate |
|
| subClassOf |
Create mapping