Jump to:
loading...| Preferred Name | baclofen | |
| Synonyms |
|
|
| Definitions |
A primary amine that has formula C10H12ClNO2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2972 |
|
| alternative term |
InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14) C10H12ClNO2 baclofen (+-)-Baclofen baclofenum DL-4-Amino-3-p-chlorophenylbutanoic acid 4-amino-3-(4-chlorophenyl)butanoic acid beta-(Aminomethyl)-4-chlorobenzenepropanoic acid beta-(Aminomethyl)-p-chlorohydrocinnamic acid baclofene beta-(p-Chlorophenyl)-gamma-aminobutyric acid NCC(CC(O)=O)c1ccc(Cl)cc1 baclofeno gamma-Amino-beta-(p-chlorophenyl)butyric acid InChIKey=KPYSYYIEGFHWSV-UHFFFAOYSA-N beta-(4-Chlorophenyl)gaba 4-Amino-3-(4-chlorophenyl)butyric acid DL-Baclofen |
|
| definition |
A primary amine that has formula C10H12ClNO2. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_51371 |
|
| label |
baclofen |
|
| prefixIRI |
CHEBI:2972 |
|
| prefLabel |
baclofen |
|
| subClassOf |
Create mapping