loading...| Preferred Name |
(R)-adrenaline |
|
| Synonyms |
|
|
| Definitions |
An adrenaline that has formula C9H13NO3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28918 |
|
| alternative term |
(R)-(-)-Epinephrine epinephrine 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol (R)-(-)-adrenaline levoepinephrine (R)-(-)-Adnephrine epinephrinum Epipen JR (-)-3,4-dihydroxy-alpha-((methylamino)methyl)benzyl alcohol adrenaline L-Adrenaline (R)-(-)-Epirenamine 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol (-)-adrenaline Epinephrin C9H13NO3 CNC[C@H](O)c1ccc(O)c(O)c1 Adrenalin Epipen InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1 Primatene (R)-(-)-Adrenaline InChIKey=UCTWMZQNUQWSLP-VIFPVBQESA-N (-)-(R)-epinephrine epinefrina |
|
| definition |
An adrenaline that has formula C9H13NO3. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37886 |
|
| is enantiomer of | ||
| label |
(R)-adrenaline |
|
| prefixIRI |
CHEBI:28918 |
|
| prefLabel |
(R)-adrenaline |
|
| subClassOf |