Jump to:
loading...| Preferred Name | coumarin | |
| Synonyms |
|
|
| Definitions |
A member of the coumarins that has formula C9H6O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28794 |
|
| alternative term |
2H-chromen-2-one o-hydroxycinnamic acid delta-lactone Cumarin InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H Tonka bean camphor cis-o-Coumarinic acid lactone Coumarine C9H6O2 2H-1-Benzopyran-2-one 2-Propenoic acid, 3-(2-hydroxyphenyl)-, d-lactone Coumarinic anhydride Rattex o-Hydroxycinnamic acid lactone InChIKey=ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 1,2-Benzopyrone 2H-benzo[b]pyran-2-one O=c1ccc2ccccc2o1 5,6-Benzo-2-pyrone Benzo-a-pyrone |
|
| definition |
A member of the coumarins that has formula C9H6O2. |
|
| label |
coumarin |
|
| prefixIRI |
CHEBI:28794 |
|
| prefLabel |
coumarin |
|
| subClassOf |
Create mapping