Preferred Name |
triethanolamine |
|
Synonyms |
|
|
Definitions |
An amino alcohol that has formula C6H15NO3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28621 |
|
alternative term |
tris(beta-hydroxyethyl)amine 2,2',2''-nitrilotris(ethanol) InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2 nitrilotriethanol nitrilo-2,2',2''-triethanol InChIKey=GSEJCLTVZPLZKY-UHFFFAOYSA-N TEA triethanolamine Trolamine Triethanolamine OCCN(CCO)CCO H3tea N(CH2CH2OH)3 2,2',2''-nitrilotriethanol C6H15NO3 2,2',2''-NITRILOTRIETHANOL tris(2-hydroxyethyl)amine |
|
definition |
An amino alcohol that has formula C6H15NO3. |
|
has functional parent | ||
label |
triethanolamine |
|
prefixIRI |
CHEBI:28621 |
|
prefLabel |
triethanolamine |
|
subClassOf |
Create mapping