Jump to:
loading...| Preferred Name |
triethanolamine |
|
| Synonyms |
|
|
| Definitions |
An amino alcohol that has formula C6H15NO3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28621 |
|
| alternative term |
tris(beta-hydroxyethyl)amine 2,2',2''-nitrilotris(ethanol) InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2 nitrilotriethanol nitrilo-2,2',2''-triethanol InChIKey=GSEJCLTVZPLZKY-UHFFFAOYSA-N TEA triethanolamine Trolamine Triethanolamine OCCN(CCO)CCO H3tea N(CH2CH2OH)3 2,2',2''-nitrilotriethanol C6H15NO3 2,2',2''-NITRILOTRIETHANOL tris(2-hydroxyethyl)amine |
|
| definition |
An amino alcohol that has formula C6H15NO3. |
|
| has functional parent | ||
| label |
triethanolamine |
|
| prefixIRI |
CHEBI:28621 |
|
| prefLabel |
triethanolamine |
|
| subClassOf |
Create mapping