Jump to:
loading...| Preferred Name |
ajmaline |
|
| Synonyms |
|
|
| Definitions |
An ajmalan derivative having hydroxy substituents at the 17- and 21-positions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28462 |
|
| alternative term |
(+)-Ajmaline C20H26N2O2 [H][C@@]12C[C@H]3[C@H](CC)[C@@H](O)N1[C@H]1C[C@@]4([C@H](O)C31)c1ccccc1N(C)[C@@]24[H] InChI=1S/C20H26N2O2/c1-3-10-11-8-14-17-20(12-6-4-5-7-13(12)21(17)2)9-15(16(11)18(20)23)22(14)19(10)24/h4-7,10-11,14-19,23-24H,3,8-9H2,1-2H3/t10-,11-,14-,15-,16?,17-,18+,19+,20+/m0/s1 ajmalan-17alpha,21alpha-diol InChIKey=CJDRUOGAGYHKKD-HEFSZTOGSA-N Ajmaline |
|
| definition |
An ajmalan derivative having hydroxy substituents at the 17- and 21-positions. |
|
| has parent hydride | ||
| is conjugate base of | ||
| label |
ajmaline |
|
| prefixIRI |
CHEBI:28462 |
|
| prefLabel |
ajmaline |
|
| subClassOf |
Create mapping